N-Acetylanthranilic acid
N-Acetylanthranilic acid
CAS: 89-52-1
Molecular Formula: C9H9NO3
N-Acetylanthranilic acid - Names and Identifiers
| Name | N-Acetylanthranilic acid |
| Synonyms | Lappaconiticacid 2-carboxyacetanilide acetylanthranilicacid 2-Acetamidobenzoic acid n-acetyl-anthranilicaci 2-(acetylamino)benzoate n-acetylaminobenzoicacid o-acetamido benzoic acid N-Acetylanthranilic acid 2-(acetylamino)-benzoicaci 2-(acetylamino)-6-aminobenzoic acid N-Acetylanthranilic acid~2-Carboxyacetanilide |
| CAS | 89-52-1 |
| EINECS | 201-914-4 |
| InChI | InChI=1/C9H9NO3/c1-6(11)10-8-5-3-2-4-7(8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13)/p-1 |
N-Acetylanthranilic acid - Physico-chemical Properties
| Molecular Formula | C9H9NO3 |
| Molar Mass | 179.17 |
| Density | 1.2822 (rough estimate) |
| Melting Point | 184-187°C(lit.) |
| Boling Point | 311.69°C (rough estimate) |
| Flash Point | 209.5°C |
| Water Solubility | slightly soluble |
| Vapor Presure | 6.67E-08mmHg at 25°C |
| BRN | 880371 |
| pKa | pK1: 3.63 (25°C) |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.5600 (estimate) |
| Physical and Chemical Properties | Needle crystals. Melting point 185 ℃. Easily soluble in ether, benzene, acetone and hot water, acetic acid, and alcohol. |
N-Acetylanthranilic acid - Risk and Safety
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| RTECS | CB2455000 |
| TSCA | Yes |
| HS Code | 29242300 |
| Hazard Note | Irritant |
| Toxicity | LD50 orl-mus: 1114 mg/kg FRPSAX 38,847,83 |
